Bulk Discount Available!
Melatonin, 500 mg (PHR1767-500MG)
MilliporeSigma® (Sigma-Aldrich)
$207.53
Earn points on this purchase
| InChI key | DRLFMBDRBRZALE-UHFFFAOYSA-N |
| form | solid |
| CAS_NO | 73-31-4 |
| grade | certified reference material |
| application(s) | pharmaceutical (small molecule) |
| agency | traceable to USP 1380105 |
| CofA | current certificate can be downloaded |
| technique(s) | gas chromatography (GC): suitable |
| packaging | pkg of 500 mg |
| InChI | 1S/C13H16N2O2/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) |
| SMILES string | COc1ccc2[nH]cc(CCNC(C)=O)c2c1 |
| technique(s) | HPLC: suitable |
| grade | pharmaceutical secondary standard |
| mp | 116.5-118 °C (lit.) |
| API family | melatonin |
| agency | traceable to BP 1077 |
| storage temp. | 2-8°C |
| Quality Level | 300 |