Bulk Discount Available!
Memantine Related Compound C, 1 X 100 mg (PHR2451-100MG)
MilliporeSigma® (Sigma-Aldrich)
$931.76
Earn points on this purchase
| CofA | current certificate can be downloaded |
| Quality Level | 300 |
| form | liquid |
| application(s) | pharmaceutical small molecule |
| SMILES string | C[C@]12CC3C[C@](C)(C1)CC(Cl)(C3)C2 |
| agency | traceable to USP 1380535 |
| InChI key | PXDRFQZLDWZHPX-CDECOKDKSA-N |
| grade | certified reference material |
| API family | memantine |
| storage temp. | 2-8°C |
| packaging | pkg of 100 mg |
| CAS_NO | 707-36-8 |
| grade | pharmaceutical secondary standard |
| InChI | 1S/C12H19Cl/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8H2,1-2H3/t9-,10+,11-,12- |