Bulk Discount Available!
(±)-Methadone-D3 solution, 1 X 1 mL (M-021-1ML)
MilliporeSigma® (Sigma-Aldrich)
$174.35
Earn points on this purchase
| manufacturer/tradename | Cerilliant® |
| form | liquid |
| InChI | 1S/C21H27NO/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17H,5,16H2,1-4H3/i1D3 |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| packaging | ampule of 1 mL |
| CAS_NO | 60263-63-0 |
| technique(s) | liquid chromatography (LC): suitable |
| mass shift | M+3 |
| storage temp. | 2-8°C |
| SMILES string | [2H]C([2H])([2H])CC(=O)C(CC(C)N(C)C)(c1ccccc1)c2ccccc2 |
| technique(s) | gas chromatography (GC): suitable |
| drug control | Narcotic Licence Schedule A (Switzerland); estupefaciente (Spain); Decreto Lei 15/93: Tabela IA (Portugal) |
| grade | certified reference material |
| concentration | 1.0 mg/mL in methanol |
| Quality Level | 300 |
| format | single component solution |
| application(s) | forensics and toxicology |
| InChI key | USSIQXCVUWKGNF-FIBGUPNXSA-N |