Bulk Discount Available!
Methyl α-ᴅ-glucopyranoside, 1 X 100 g (66940-100G)
MilliporeSigma® (Sigma-Aldrich)
$72.06
Earn points on this purchase
| SMILES string | CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| mp | 165-169 °C |
| optical activity | [α]20/D +157±3°, c = 10% in H2O |
| assay | ≥99.0% (sum of enantiomers, HPLC) |
| Quality Level | 200 |
| CAS_NO | 97-30-3 |
| packaging | pkg of 100 g |
| application(s) | microbiology |
| assay | ≥99.0% |
| color | colorless |
| InChI | 1S/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4-,5+,6-,7+/m1/s1 |
| InChI key | HOVAGTYPODGVJG-ZFYZTMLRSA-N |
| form | crystalline powder |
| storage condition | (Keep container tightly closed in a dry and well-ventilated place.) |