Bulk Discount Available!
Methyl Orange, 1 X 25 g (114510-25G)
MilliporeSigma® (Sigma-Aldrich)
$55.90
Earn points on this purchase
| technique(s) | titration: suitable |
| InChI key | STZCRXQWRGQSJD-GEEYTBSJSA-M |
| grade | ACS reagent |
| visual transition interval | 3.2-4.4, red to yellow |
| application(s) | diagnostic assay manufacturinghematologyhistology |
| color | orange |
| storage temp. | room temp |
| Quality Level | 200 |
| CAS_NO | 547-58-0 |
| pH | 3.0-4.4, pink to yellow |
| λmax | 505 nm |
| SMILES string | [Na+].CN(C)c1ccc(cc1)\N=N\c2ccc(cc2)S([O-])(=O)=O |
| composition | Dye content, 85% |
| form | powder |
| mp | >300 °C |
| InChI | 1S/C14H15N3O3S.Na/c1-17(2)13-7-3-11(4-8-13)15-16-12-5-9-14(10-6-12)21(18,19)20;/h3-10H,1-2H3,(H,18,19,20);/q;+1/p-1/b16-15+; |