Bulk Discount Available!
Methyl Red solution, 1 X 100 mL (08714-100ML-F)
MilliporeSigma® (Sigma-Aldrich)
$49.12
Earn points on this purchase
| product line | BioChemika |
| application(s) | microbiology |
| SMILES string | CN(C)c1ccc(cc1)\N=N\c2ccccc2C(O)=O |
| technique(s) | microbe id | metabolite detection: suitable |
| shelf life | limited shelf life, expiry date on the label |
| suitability | Staphylococcus spp. |
| suitability | Proteus spp. |
| composition | methyl red, 0.1 g |
| agency | according to ISO 22964:2017 |
| suitability | Escherichia coli |
| Quality Level | 200 |
| composition | dist. water, 200 mL |
| CAS_NO | 493-52-7 |
| agency | according to GB 4789.30-2016 |
| suitability | Pseudomonas spp. |
| InChI key | CEQFOVLGLXCDCX-WUKNDPDISA-N |
| application(s) | clinical testingenvironmentalfood and beverages |
| suitability | Klebsiella spp. |
| composition | ethanol 95%, 300 mL |
| suitability | Enterococcus spp. |
| InChI | 1S/C15H15N3O2/c1-18(2)12-9-7-11(8-10-12)16-17-14-6-4-3-5-13(14)15(19)20/h3-10H,1-2H3,(H,19,20)/b17-16+ |
| suitability | bacteria |