Bulk Discount Available!
Methyldopa, 1 X 1 g (PHR2672-1G)
MilliporeSigma® (Sigma-Aldrich)
$387.39
Earn points on this purchase
| mp | ≥300 °C |
| SMILES string | C[C@](N)(Cc1ccc(O)c(O)c1)C(O)=O |
| storage temp. | 2-30°C |
| InChI | 1S/C10H13NO4/c1-10(11,9(14)15)5-6-2-3-7(12)8(13)4-6/h2-4,12-13H,5,11H2,1H3,(H,14,15)/t10-/m0/s1 |
| grade | pharmaceutical secondary standard |
| API family | methyldopa |
| CofA | current certificate can be downloaded |
| agency | traceable to USP 1426002 |
| InChI key | CJCSPKMFHVPWAR-JTQLQIEISA-N |
| agency | traceable to Ph. Eur. M1500000 |
| form | powder |
| Quality Level | 300 |
| grade | certified reference material |
| packaging | pkg of 1000 mg |
| application(s) | pharmaceutical small molecule |
| CAS_NO | 41372-08-1 |