Bulk Discount Available!
N-Acetyl-ʟ-tryptophan, 1 X 500 mg (PHR1177-500MG)
MilliporeSigma® (Sigma-Aldrich)
$157.59
Earn points on this purchase
| grade | pharmaceutical secondary standard |
| agency | traceable to USP 1700523 |
| application(s) | pharmaceutical (small molecule) |
| technique(s) | HPLC: suitable |
| InChI key | DZTHIGRZJZPRDV-LBPRGKRZSA-N |
| CofA | current certificate can be downloaded |
| grade | certified reference material |
| Quality Level | 300 |
| format | neat |
| API family | tryptophan |
| CAS_NO | 1218-34-4 |
| technique(s) | gas chromatography (GC): suitable |
| SMILES string | CC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O |
| agency | traceable to Ph. Eur. A0208000 |
| InChI | 1S/C13H14N2O3/c1-8(16)15-12(13(17)18)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7,12,14H,6H2,1H3,(H,15,16)(H,17,18)/t12-/m0/s1 |
| storage temp. | 2-8°C |