Bulk Discount Available!
Nalidixic acid, 1 X 100 g (N8878-100G)
MilliporeSigma® (Sigma-Aldrich)
$356.00
Earn points on this purchase
| solubility | chloroform: 50 mg/mL |
| InChI key | MHWLWQUZZRMNGJ-UHFFFAOYSA-N |
| SMILES string | CCN1C=C(C(O)=O)C(=O)c2ccc(C)nc12 |
| mp | 227-229 °C (lit.) |
| mode of action | enzyme | inhibits |
| mode of action | DNA synthesis | interferes |
| form | powder |
| antibiotic activity spectrum | Gram-negative bacteria |
| antibiotic activity spectrum | Gram-positive bacteria |
| biological source | synthetic |
| assay | ≥98% |
| Quality Level | 200 |
| CAS_NO | 389-08-2 |
| InChI | 1S/C12H12N2O3/c1-3-14-6-9(12(16)17)10(15)8-5-4-7(2)13-11(8)14/h4-6H,3H2,1-2H3,(H,16,17) |