Bulk Discount Available!
Naloxone-D₅ solution, 1 X 1 mL (N-063-1ML)
MilliporeSigma® (Sigma-Aldrich)
$505.18
Earn points on this purchase
| format | single component solution |
| concentration | 100 μg/mL in methanol |
| grade | certified reference material |
| technique(s) | gas chromatography (GC): suitable |
| Quality Level | 300 |
| form | liquid |
| manufacturer/tradename | Cerilliant® |
| InChI key | UZHSEJADLWPNLE-HEEDNVRVSA-N |
| technique(s) | liquid chromatography (LC): suitable |
| storage temp. | −20°C |
| packaging | ampule of 1 mL |
| application(s) | forensics and toxicology |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| CAS_NO | 1261079-38-2 |
| InChI | 1S/C19H21NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h2-4,14,17,21,23H,1,5-10H2/t14-,17+,18+,19-/m1/s1/i1D2,2D,8D2 |
| SMILES string | [2H]\C([2H])=C(/[2H])C([2H])([2H])N1CC[C@]23[C@H]4Oc5c(O)ccc(C[C@@H]1[C@]2(O)CCC4=O)c35 |