Bulk Discount Available!
Naltrexone-3-β-D-glucuronide solution, 1 mL (N-106-1ML)
MilliporeSigma® (Sigma-Aldrich)
$270.47
Earn points on this purchase
| technique(s) | liquid chromatography (LC): suitable |
| storage temp. | −20°C |
| format | single component solution |
| SMILES string | N2([C@H]3[C@]4([C@@]5([C@@H](Oc6c5c(ccc6O[C@@H]7O[C@@H]([C@H]([C@@H]([C@H]7O)O)O)C(=O)O)C3)C(=O)CC4)CC2)O)CC1CC1 |
| form | liquid |
| CAS_NO | 76630-71-2 |
| grade | certified reference material |
| shipped in | wet ice |
| application(s) | forensics and toxicology |
| packaging | ampule of 1 mL |
| manufacturer/tradename | Cerilliant® |
| InChI | 1S/C26H31NO10/c28-13-5-6-26(34)15-9-12-3-4-14(35-24-19(31)17(29)18(30)21(37-24)23(32)33)20-16(12)25(26,22(13)36-20)7-8-27(15)10-11-1-2-11/h3-4,11,15,17-19,21-22,24,29-31,34H,1-2,5-10H2,(H,32,33)/t15-,17+,18+,19-,21+,22+,24-,25+,26-/m1/s1 |
| technique(s) | gas chromatography (GC): suitable |
| InChI key | KCSKQJYZSCIQRR-ODTDCTFRSA-N |
| concentration | 100 μg/mL in methanol |
| Quality Level | 300 |
| feature | Snap-N-Spike®/Snap-N-Shoot® |