Bulk Discount Available!
Naltrexone solution, 1 X 1 mL (N-007-1ML)
MilliporeSigma® (Sigma-Aldrich)
$43.36
Earn points on this purchase
| application(s) | forensics and toxicology |
| form | liquid |
| Quality Level | 300 |
| InChI key | DQCKKXVULJGBQN-XFWGSAIBSA-N |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| InChI | 1S/C20H23NO4/c22-13-4-3-12-9-15-20(24)6-5-14(23)18-19(20,16(12)17(13)25-18)7-8-21(15)10-11-1-2-11/h3-4,11,15,18,22,24H,1-2,5-10H2/t15-,18+,19+,20-/m1/s1 |
| technique(s) | gas chromatography (GC): suitable |
| shipped in | wet ice |
| technique(s) | liquid chromatography (LC): suitable |
| grade | certified reference material |
| storage temp. | 2-8°C |
| packaging | ampule of 1 mL |
| SMILES string | Oc1ccc2C[C@H]3N(CC[C@@]45[C@@H](Oc1c24)C(=O)CC[C@@]35O)CC6CC6 |
| concentration | 1.0 mg/mL in methanol |
| Gene Information | human ... OPRD1(4985), OPRK1(4986), OPRM1(4988) |
| CAS_NO | 16590-41-3 |
| format | single component solution |
| manufacturer/tradename | Cerilliant® |