Bulk Discount Available!
Natamycin, 1 g (PHR1703-1G)
MilliporeSigma® (Sigma-Aldrich)
$198.94
Earn points on this purchase
| agency | traceable to USP 1457505 |
| technique(s) | gas chromatography (GC): suitable |
| Quality Level | 300 |
| CofA | current certificate can be downloaded |
| storage temp. | -10 to -25°C |
| InChI key | NCXMLFZGDNKEPB-FFPOYIOWSA-N |
| application(s) | pharmaceutical (small molecule) |
| CAS_NO | 7681-93-8 |
| technique(s) | HPLC: suitable |
| API family | natamycin |
| format | neat |
| SMILES string | C[C@@H]1C\C=C\C=C\C=C\C=C\[C@@H](C[C@@H]2O[C@](O)(C[C@@H](O)C[C@H]3O[C@@H]3\C=C\C(=O)O1)C[C@H](O)[C@H]2C(O)=O)O[C@@H]4O[C@H](C)[C@@H](O)[C@H](N)[C@@H]4O |
| grade | pharmaceutical secondary standard |
| InChI | 1S/C33H47NO13/c1-18-10-8-6-4-3-5-7-9-11-21(45-32-30(39)28(34)29(38)19(2)44-32)15-25-27(31(40)41)22(36)17-33(42,47-25)16-20(35)14-24-23(46-24)12-13-26(37)43-18/h3-9,11-13,18-25,27-30,32,35-36,38-39,42H,10,14-17,34H2,1-2H3,(H,40,41)/b4-3+,7-5+,8-6+,11-9+,13-12+/t18-,19-,20+,21+,22+,23-,24-,25+,27-,28+,29-,30+,32+,33-/m1/s1 |
| grade | certified reference material |
| packaging | pkg of 1 g |