Bulk Discount Available!
Neutral Red, 1 X 1 g (N7005-1G)
MilliporeSigma® (Sigma-Aldrich)
$48.60
Earn points on this purchase
| SMILES string | Cl.CN(C)c1ccc2nc3cc(C)c(N)cc3nc2c1 |
| mp | 290 °C (dec.) (lit.) |
| InChI key | PGSADBUBUOPOJS-UHFFFAOYSA-N |
| color | brown to black |
| solubility | water: 10 mg/mL, dark red |
| InChI | 1S/C15H16N4.ClH/c1-9-6-13-15(8-11(9)16)18-14-7-10(19(2)3)4-5-12(14)17-13;/h4-8H,16H2,1-3H3;1H |
| Quality Level | 200 |
| application(s) | diagnostic assay manufacturinghematologyhistology |
| composition | Dye content, ≥90% |
| CAS_NO | 553-24-2 |
| form | powder |
| pH | 6.8-8.0, red to yellow |
| storage temp. | 2-8°C |
| technique(s) | titration: suitable |