Bulk Discount Available!
Norcodeine solution, 1 X 1 mL (N-005-1ML)
MilliporeSigma® (Sigma-Aldrich)
$48.95
Earn points on this purchase
| manufacturer/tradename | Cerilliant® |
| application(s) | forensics and toxicology |
| drug control | Narcotic Licence Schedule A (Switzerland); estupefaciente (Spain); Decreto Lei 15/93: Tabela IA (Portugal) |
| concentration | 1.0 mg/mL in methanol |
| Quality Level | 300 |
| form | liquid |
| CAS_NO | 467-15-2 |
| grade | certified reference material |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| InChI | 1S/C17H19NO3/c1-20-13-5-2-9-8-11-10-3-4-12(19)16-17(10,6-7-18-11)14(9)15(13)21-16/h2-5,10-12,16,18-19H,6-8H2,1H3/t10-,11+,12-,16-,17-/m0/s1 |
| SMILES string | COc1ccc2C[C@H]3NCC[C@@]45[C@@H](Oc1c24)[C@@H](O)C=C[C@@H]35 |
| packaging | ampule of 1 mL |
| InChI key | HKOIXWVRNLGFOR-KOFBORESSA-N |
| format | single component solution |
| storage temp. | −20°C |
| technique(s) | gas chromatography (GC): suitable |
| technique(s) | liquid chromatography (LC): suitable |