Bulk Discount Available!
(±)-Norketamine hydrochloride solution, 1 X 1 mL (N-036-1ML)
MilliporeSigma® (Sigma-Aldrich)
$49.40
Earn points on this purchase
| InChI key | CLPOJGPBUGCUKT-UHFFFAOYSA-N |
| storage temp. | −20°C |
| InChI | 1S/C12H14ClNO.ClH/c13-10-6-2-1-5-9(10)12(14)8-4-3-7-11(12)15;/h1-2,5-6H,3-4,7-8,14H2;1H |
| CAS_NO | 79499-59-5 |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| concentration | 1.0 mg/mL in methanol (as free base) |
| application(s) | forensics and toxicology |
| grade | certified reference material |
| technique(s) | liquid chromatography (LC): suitable |
| manufacturer/tradename | Cerilliant® |
| packaging | ampule of 1 mL |
| format | single component solution |
| Quality Level | 300 |
| technique(s) | gas chromatography (GC): suitable |
| form | liquid |
| SMILES string | Cl.NC1(CCCCC1=O)c2ccccc2Cl |