Bulk Discount Available!
(±)-Nornicotine-d₄, 1 X 1 mL (N-072-1ML)
MilliporeSigma® (Sigma-Aldrich)
$162.06
Earn points on this purchase
| application(s) | forensics and toxicology |
| SMILES string | N1C(CCC1)c2c(nc(c(c2[2H])[2H])[2H])[2H] |
| technique(s) | gas chromatography (GC): suitable |
| concentration | 100 μg/mL in methanol |
| storage temp. | −20°C |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| grade | certified reference material |
| Quality Level | 300 |
| format | single component solution |
| CAS_NO | 66148-18-3 |
| packaging | ampule of 1 mL |
| InChI key | MYKUKUCHPMASKF-DNZPNURCSA-N |
| InChI | 1S/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7,9,11H,2,4,6H2/i1D,3D,5D,7D |
| form | liquid |
| manufacturer/tradename | Cerilliant® |
| technique(s) | liquid chromatography (LC): suitable |