Bulk Discount Available!
(+)-Norpropoxyphene maleate solution, 1 X 1 mL (N-913-1ML)
MilliporeSigma® (Sigma-Aldrich)
$48.95
Earn points on this purchase
| form | liquid |
| technique(s) | liquid chromatography (LC): suitable |
| SMILES string | OC(=O)\C=C/C(O)=O.CCC(=O)O[C@@](Cc1ccccc1)([C@H](C)CNC)c2ccccc2 |
| format | single component solution |
| Quality Level | 300 |
| manufacturer/tradename | Cerilliant® |
| grade | certified reference material |
| concentration | 1.0 mg/mL in methanol (as free base) |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| packaging | ampule of 1 mL |
| storage temp. | 2-8°C |
| application(s) | forensics and toxicology |
| InChI key | HCQPFYNZJNOOKN-YKNFWSLESA-N |
| technique(s) | gas chromatography (GC): suitable |
| InChI | 1S/C21H27NO2.C4H4O4/c1-4-20(23)24-21(17(2)16-22-3,19-13-9-6-10-14-19)15-18-11-7-5-8-12-18;5-3(6)1-2-4(7)8/h5-14,17,22H,4,15-16H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t17-,21+;/m1./s1 |
| CAS_NO | 159208-83-0 |