Bulk Discount Available!
Oil Red O, 1 X 25 g (O0625-25G)
MilliporeSigma® (Sigma-Aldrich)
$69.55
Earn points on this purchase
| color | dark red to brown |
| grade | certified by the Biological Stain Commission |
| application(s) | diagnostic assay manufacturinghematologyhistology |
| SMILES string | Cc1ccc(C)c(c1)\N=N\c2cc(C)c(cc2C)\N=N/c3c(O)ccc4ccccc34 |
| Quality Level | 200 |
| InChI key | NPGIHFRTRXVWOY-UHFFFAOYSA-N |
| CAS_NO | 1320-06-5 |
| form | powder |
| composition | Dye content, ≥75% |
| InChI | 1S/C26H24N4O/c1-16-9-10-17(2)22(13-16)27-28-23-14-19(4)24(15-18(23)3)29-30-26-21-8-6-5-7-20(21)11-12-25(26)31/h5-15,31H,1-4H3 |
| storage temp. | room temp |
| solubility | chloroform/ethanol (1:1): 1 mg/mL |
| technique(s) | microbe id | staining: suitable |
| mp | 120 °C (dec.) (lit.) |