Bulk Discount Available!
Omeprazole Related Compound E, 30 mg (PHR1649-30MG)
MilliporeSigma® (Sigma-Aldrich)
$817.00
Earn points on this purchase
| technique(s) | HPLC: suitable |
| storage temp. | 2-8°C |
| SMILES string | [S](=O)(Cc3[n+](cc(c(c3C)OC)C)[O-])c1[nH]c2c(n1)ccc(c2)OC |
| grade | pharmaceutical secondary standard |
| packaging | pkg of 30 mg |
| API family | omeprazole |
| InChI key | QZVDQETYNOBUPJ-UHFFFAOYSA-N |
| grade | certified reference material |
| agency | traceable to USP 1478527 |
| application(s) | pharmaceutical (small molecule) |
| technique(s) | gas chromatography (GC): suitable |
| CAS_NO | 176219-04-8 |
| Quality Level | 300 |
| CofA | current certificate can be downloaded |
| InChI | 1S/C17H19N3O4S/c1-10-8-20(21)15(11(2)16(10)24-4)9-25(22)17-18-13-6-5-12(23-3)7-14(13)19-17/h5-8H,9H2,1-4H3,(H,18,19) |
| format | neat |