Bulk Discount Available!
Orange G, 1 X 25 g (O7252-25G)
MilliporeSigma® (Sigma-Aldrich)
$80.50
Earn points on this purchase
| technique(s) | microbe id | staining: suitable |
| form | powder |
| color | orange to very dark orange |
| InChI | 1S/C16H12N2O7S2.2Na/c19-13-7-6-10-8-12(26(20,21)22)9-14(27(23,24)25)15(10)16(13)18-17-11-4-2-1-3-5-11;;/h1-9,19H,(H,20,21,22)(H,23,24,25);;/q;2*+1/p-2/b18-17+;; |
| grade | certified by the Biological Stain Commission |
| SMILES string | [Na+].[Na+].Oc1ccc2cc(cc(c2c1\N=N\c3ccccc3)S([O-])(=O)=O)S([O-])(=O)=O |
| application(s) | diagnostic assay manufacturinghematologyhistology |
| composition | Dye content, ≥80% |
| solubility | water: 1 mg/mL, clear |
| CAS_NO | 1936-15-8 |
| InChI key | HSXUHWZMNJHFRV-QIKYXUGXSA-L |
| Quality Level | 200 |
| storage temp. | room temp |