Bulk Discount Available!
Oxcarbazepine, 1 g (PHR1635-1G)
MilliporeSigma® (Sigma-Aldrich)
$210.12
Earn points on this purchase
| InChI key | CTRLABGOLIVAIY-UHFFFAOYSA-N |
| technique(s) | HPLC: suitable |
| grade | pharmaceutical secondary standard |
| Gene Information | human ... SCN10A(6336), SCN11A(11280), SCN1A(6323), SCN2A(6326), SCN3A(6328), SCN4A(6329), SCN5A(6331), SCN7A(6332), SCN8A(6334), SCN9A(6335) |
| grade | certified reference material |
| CofA | current certificate can be downloaded |
| application(s) | pharmaceutical (small molecule) |
| technique(s) | gas chromatography (GC): suitable |
| Quality Level | 300 |
| format | neat |
| API family | oxcarbazepine |
| agency | traceable to Ph. Eur. Y0001576 |
| SMILES string | O=C1CC2=C(C=CC=C2)N(C(N)=O)C3=CC=CC=C31 |
| CAS_NO | 28721-07-5 |
| packaging | pkg of 1 g |
| agency | traceable to USP 1483152 |
| storage temp. | 2-8°C |
| InChI | 1S/C15H12N2O2/c16-15(19)17-12-7-3-1-5-10(12)9-14(18)11-6-2-4-8-13(11)17/h1-8H,9H2,(H2,16,19) |