Bulk Discount Available!
p-Fluorofentanyl solution, 0.5 mL (F-049-0.5ML)
MilliporeSigma® (Sigma-Aldrich)
$127.41
Earn points on this purchase
| packaging | ampule of 0.5 mL |
| drug control | estupefaciente (Spain); Decreto Lei 15/93: Tabela IA (Portugal) |
| Quality Level | 300 |
| CAS_NO | 90736-23-5 |
| InChI | 1S/C22H27FN2O/c1-2-22(26)25(20-10-8-19(23)9-11-20)21-13-16-24(17-14-21)15-12-18-6-4-3-5-7-18/h3-11,21H,2,12-17H2,1H3 |
| technique(s) | gas chromatography (GC): suitable |
| application(s) | forensics and toxicology |
| storage temp. | −20°C |
| SMILES string | Fc1ccc(cc1)N(C2CCN(CC2)CCc3ccccc3)C(=O)CC |
| grade | certified reference material |
| manufacturer/tradename | Cerilliant® |
| concentration | 100 μg/mL in methanol |
| form | liquid |
| InChI key | KXUBAVLIJFTASZ-UHFFFAOYSA-N |
| technique(s) | liquid chromatography (LC): suitable |
| format | single component solution |
| feature | Snap-N-Spike®/Snap-N-Shoot® |