Bulk Discount Available!
Pentobarbital solution, 1 X 1 mL (P-010-1ML)
MilliporeSigma® (Sigma-Aldrich)
$31.64
Earn points on this purchase
| CAS_NO | 76-74-4 |
| InChI key | WEXRUCMBJFQVBZ-UHFFFAOYSA-N |
| form | liquid |
| SMILES string | CCCC(C)C1(CC)C(=O)NC(=O)NC1=O |
| concentration | 1.0 mg/mL in methanol |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| manufacturer/tradename | Cerilliant® |
| Gene Information | human ... GABRA1(2554), GABRA2(2555), GABRA3(2556), GABRA4(2557), GABRA5(2558), GABRA6(2559), GABRB1(2560), GABRB2(2561), GABRB3(2562), GABRD(2563), GABRE(2564), GABRG1(2565), GABRG2(2566), GABRG3(2567), GABRP(2568), GABRQ(55879) |
| packaging | ampule of 1 mL |
| application(s) | forensics and toxicology |
| technique(s) | gas chromatography (GC): suitable |
| format | single component solution |
| Quality Level | 300 |
| InChI | 1S/C11H18N2O3/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16) |
| storage temp. | 2-8°C |
| grade | certified reference material |
| drug control | Narcotic Licence Schedule B (Switzerland); psicótropo (Spain); Decreto Lei 15/93: Tabela IIC (Portugal) |
| technique(s) | liquid chromatography (LC): suitable |