Bulk Discount Available!
Primidone solution, 1 X 1 mL (P-075-1ML)
MilliporeSigma® (Sigma-Aldrich)
$81.93
Earn points on this purchase
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| concentration | 1.0 mg/mL in methanol |
| technique(s) | liquid chromatography (LC): suitable |
| packaging | ampule of 1 mL |
| format | single component solution |
| storage temp. | −20°C |
| InChI | 1S/C12H14N2O2/c1-2-12(9-6-4-3-5-7-9)10(15)13-8-14-11(12)16/h3-7H,2,8H2,1H3,(H,13,15)(H,14,16) |
| technique(s) | gas chromatography (GC): suitable |
| CAS_NO | 125-33-7 |
| InChI key | DQMZLTXERSFNPB-UHFFFAOYSA-N |
| SMILES string | CCC1(C(=O)NCNC1=O)c2ccccc2 |
| manufacturer/tradename | Cerilliant® |
| grade | certified reference material |
| Quality Level | 300 |
| application(s) | forensics and toxicology |
| form | liquid |
| Gene Information | human ... GABRA1(2554), GABRA2(2555), GABRA3(2556), GABRA4(2557), GABRA5(2558), GABRA6(2559), GABRB1(2560), GABRB2(2561), GABRB3(2562), GABRD(2563), GABRE(2564), GABRG1(2565), GABRG2(2566), GABRG3(2567), GABRP(2568), GABRQ(55879), SCN10A(6336), SCN11A(11280), SCN1A(6323), SCN2A(6326), SCN3A(6328), SCN4A(6329), SCN5A(6331), SCN7A(6332), SCN8A(6334), SCN9A(6335) |