Bulk Discount Available!
Promethazine Related Compound B, 1 X 50 mg (PHR2777-50MG)
MilliporeSigma® (Sigma-Aldrich)
$699.11
Earn points on this purchase
| grade | certified reference material |
| API family | promethazine |
| grade | pharmaceutical secondary standard |
| InChI key | RISCHQYUHLQSBU-UHFFFAOYSA-N |
| SMILES string | S1c2c(cccc2)N(c3c1cccc3)C(CN(C)C)C.Cl |
| InChI | 1S/C17H20N2S.ClH/c1-13(12-18(2)3)19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19;/h4-11,13H,12H2,1-3H3;1H |
| application(s) | pharmaceutical small molecule |
| storage temp. | 2-30°C |
| form | powder |
| packaging | pkg of 50 mg |
| CAS_NO | 5568-90-1 |
| Quality Level | 300 |
| agency | traceable to USP 1570029 |