Bulk Discount Available!
Propyl gallate, 1 X 1 g (PHR1118-1G)
MilliporeSigma® (Sigma-Aldrich)
$111.76
Earn points on this purchase
| grade | pharmaceutical secondary standard |
| agency | traceable to USP 1576800 |
| grade | certified reference material |
| application(s) | cleaning productscosmeticsflavors and fragrancesfood and beveragespersonal carepharmaceutical (small molecule) |
| storage temp. | 2-30°C |
| technique(s) | gas chromatography (GC): suitable |
| CofA | current certificate can be downloaded |
| InChI | 1S/C10H12O5/c1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h4-5,11-13H,2-3H2,1H3 |
| SMILES string | CCCOC(=O)c1cc(O)c(O)c(O)c1 |
| API family | propyl gallate |
| Quality Level | 300 |
| CAS_NO | 121-79-9 |
| InChI key | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
| agency | traceable to Ph. Eur. P3640000 |
| format | neat |
| mp | 146-149 °C (lit.) |
| technique(s) | HPLC: suitable |