Bulk Discount Available!
Pyrogallol Red, 1 X 5 g (P8759-5G)
MilliporeSigma® (Sigma-Aldrich)
$205.00
Earn points on this purchase
| application(s) | diagnostic assay manufacturinghematologyhistology |
| solubility | 1 M NH4OH: 10 mg/mL, clear |
| color | green to very dark green, and brown |
| mp | ≥300 °C (lit.) |
| εmax | ≥450 at 475 nm in methanol |
| InChI key | KUQNCHZOCSYKOR-UHFFFAOYSA-N |
| technique(s) | titration: suitable |
| InChI | 1S/C19H12O8S/c20-12-7-5-10-17(15(12)22)26-18-11(6-8-13(21)16(18)23)19(10)9-3-1-2-4-14(9)28(24,25)27-19/h1-8,20-23H |
| form | powder |
| Quality Level | 200 |
| storage temp. | room temp |
| SMILES string | Oc1ccc2c(Oc3c(O)c(O)ccc3C24OS(=O)(=O)c5ccccc45)c1O |
| suitability | suitable for complexometric indicator |
| CAS_NO | 32638-88-3 |