Bulk Discount Available!
Raloxifene Related Compound C, 40 mg (PHR2015-40MG)
MilliporeSigma® (Sigma-Aldrich)
$927.65
Earn points on this purchase
| grade | certified reference material |
| application(s) | pharmaceutical |
| Quality Level | 300 |
| agency | traceable to USP 1598234 |
| packaging | pkg of 40 mg |
| CAS_NO | 195454-31-0 |
| InChI | 1S/C28H27NO5S/c30-21-8-4-20(5-9-21)28-26(24-13-10-22(31)18-25(24)35-28)27(32)19-6-11-23(12-7-19)34-17-16-29(33)14-2-1-3-15-29/h4-13,18,30-31H,1-3,14-17H2 |
| InChI key | KNADIZJVEMEXLS-UHFFFAOYSA-N |
| format | neat |
| grade | pharmaceutical secondary standard |
| CofA | current certificate can be downloaded |
| SMILES string | [s]1c2c(c(c1c5ccc(cc5)O)C(=O)c3ccc(cc3)OCC[N]4(=O)CCCCC4)ccc(c2)O |
| storage temp. | 2-30°C |
| API family | raloxifene |