Bulk Discount Available!
Riboflavin, 1 X 1 g (PHR1054-1G)
MilliporeSigma® (Sigma-Aldrich)
$114.00
Earn points on this purchase
| application(s) | cleaning productscosmeticsfood and beveragespersonal carepharmaceutical (small molecule) |
| CofA | current certificate can be downloaded |
| agency | traceable to Ph. Eur. R060000 |
| grade | pharmaceutical secondary standard |
| SMILES string | CC1=C(C)C=C(N(C[C@H](O)[C@@H]([C@H](O)CO)O)C(C2=N3)=NC(NC2=O)=O)C3=C1 |
| agency | traceable to USP 1603006 |
| API family | riboflavin |
| technique(s) | gas chromatography (GC): suitable |
| CAS_NO | 83-88-5 |
| technique(s) | HPLC: suitable |
| format | neat |
| InChI | 1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1 |
| grade | certified reference material |
| storage temp. | 2-8°C |
| Quality Level | 300 |
| mp | 290 °C (dec.) (lit.) |
| InChI key | AUNGANRZJHBGPY-SCRDCRAPSA-N |