Bulk Discount Available!
Ribonuclease A from bovine pancreas, 1 X 250 mg (R4642-250MG)
MilliporeSigma® (Sigma-Aldrich)
$429.18
Earn points on this purchase
| biological source | bovine pancreas |
| foreign activity | NICKase and DNase, none detected |
| foreign activity | Endonuclease and exonuclease, none detected |
| CAS_NO | 9001-99-4 |
| suitability | suitable for |
| mol wt | 13.7 kDa |
| Quality Level | 200 |
| InChI key | CQOVPNPJLQNMDC-UHFFFAOYSA-N |
| mol wt | ~13,700 |
| form | (Solution of 50% glycerol, 10mM Tris-HCL pH 8.0) |
| InChI | 1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16) |
| concentration | 20-40 mg/mL |
| grade | for molecular biology |
| SMILES string | [nH]1cnc(c1)CC(NC(=O)CCN)C(=O)O |
| storage temp. | −20°C |