Bulk Discount Available!
Salbutamol impurity I, 20 mg (PHR1962-20MG)
MilliporeSigma® (Sigma-Aldrich)
$981.29
Earn points on this purchase
| format | neat |
| InChI key | ICDQPCBDGAHBGG-UHFFFAOYSA-N |
| API family | salbutamol, albuterol, albuterol |
| CAS_NO | 56796-66-8 |
| Quality Level | 300 |
| agency | traceable to Ph. Eur. Y0000032 |
| packaging | pkg of 20 mg |
| InChI | 1S/C20H27NO3/c1-20(2,3)21-12-18(23)16-9-10-19(17(11-16)13-22)24-14-15-7-5-4-6-8-15/h4-11,18,21-23H,12-14H2,1-3H3 |
| SMILES string | N(C(C)(C)C)CC(O)c1cc(c(cc1)OCc2ccccc2)CO |
| application(s) | pharmaceutical |
| grade | pharmaceutical secondary standard |
| grade | certified reference material |
| storage temp. | 2-8°C |
| CofA | current certificate can be downloaded |