Bulk Discount Available!
Salmeterol Xinafoate, 500 mg (PHR1947-500MG)
MilliporeSigma® (Sigma-Aldrich)
$622.53
Earn points on this purchase
| CAS_NO | 94749-08-3 |
| grade | certified reference material |
| API family | salmeterol |
| InChI | 1S/C25H37NO4.C11H8O3/c27-20-23-18-22(13-14-24(23)28)25(29)19-26-15-7-1-2-8-16-30-17-9-6-12-21-10-4-3-5-11-21;12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h3-5,10-11,13-14,18,25-29H,1-2,6-9,12,15-17,19-20H2;1-6,12H,(H,13,14) |
| SMILES string | OC(=O)c1ccc2ccccc2c1O.OCc3cc(ccc3O)C(O)CNCCCCCCOCCCCc4ccccc4 |
| InChI key | XTZNCVSCVHTPAI-UHFFFAOYSA-N |
| agency | traceable to Ph. Eur. Y0000422 |
| Quality Level | 300 |
| storage temp. | 2-8°C |
| grade | pharmaceutical secondary standard |
| Gene Information | human ... ADRB2(154) |
| application(s) | pharmaceutical (small molecule) |
| form | powder |
| CofA | current certificate can be downloaded |
| technique(s) | HPLC: suitable |
| agency | traceable to USP 1609603 |
| technique(s) | gas chromatography (GC): suitable |