Bulk Discount Available!
Sodium Alginate, 1 g (PHR1471-1G)
MilliporeSigma® (Sigma-Aldrich)
$198.94
Earn points on this purchase
| grade | pharmaceutical secondary standard |
| SMILES string | [Na+].[O-]C(=O)C1O[C@H]([C@H]([C@H]([C@@H]1O)O)O)O |
| format | neat |
| storage temp. | 2-30°C |
| CofA | current certificate can be downloaded |
| InChI | 1S/C6H10O7.Na/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;/h1-4,6-9,12H,(H,10,11);/q;+1/p-1/t1-,2-,3-,4?,6+;/m0./s1 |
| agency | traceable to USP 1613462 |
| technique(s) | gas chromatography (GC): suitable |
| InChI key | MSXHSNHNTORCAW-MPGIDXPLSA-M |
| application(s) | pharmaceutical (small molecule) |
| technique(s) | HPLC: suitable |
| Quality Level | 300 |
| packaging | pkg of 1 g |
| grade | certified reference material |
| API family | sodium alginate |
| CAS_NO | 9005-38-3 |