Bulk Discount Available!

Sucrose, 1 X 1 kg (S5016-1KG)
MilliporeSigma® (Sigma-Aldrich)
$118.00
Earn points on this purchase
useful pH range | 5.5-7.5 (25 °C, 342 g/L) |
technique(s) | HPLC: suitable |
application(s) | agriculturecell analysislife science and biopharmametabolomics |
cation traces | Fe: ≤5 ppm |
mp | 185-187 °C (lit.) |
color | white |
InChI | 1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
technique(s) | cryopreservation: suitable |
impurities | ≤0.05% Invert sugar |
impurities | ≤0.005% Insoluble matter |
form | powder or crystals |
ign. residue | ≤0.01% |
Quality Level | 300 |
impurities | ≤0.0008 meq/g Titratable acid |
InChI key | CZMRCDWAGMRECN-UGDNZRGBSA-N |
solubility | soluble 342 g/L at 20 °C (completely) |
loss | ≤0.03% loss on drying, 105°C |
cation traces | heavy metals: ≤5 ppm (by ICP-OES) |
CAS_NO | 57-50-1 |
SMILES string | OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
biological source | sugar cane |
grade | ACS reagent |
anion traces | chloride (Cl-): ≤0.005% |
storage temp. | room temp |
technique(s) | immunohistochemistry: suitable |
anion traces | sulfate, sulfite (as SO42-): ≤0.005% |
optical activity | [α]25/D +66.3 to +66.8°(lit.) |