Bulk Discount Available!
Tapentadol hydrochloride solution, 1 X 1 mL (T-058-1ML)
MilliporeSigma® (Sigma-Aldrich)
$287.24
Earn points on this purchase
| storage temp. | −20°C |
| technique(s) | gas chromatography (GC): suitable |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| Gene Information | human ... OPRM1(4988), SLC6A2(6530) |
| grade | certified reference material |
| drug control | Narcotic Licence Schedule A (Switzerland); estupefaciente (Spain); Decreto Lei 15/93: Tabela IA (Portugal) |
| form | liquid |
| packaging | ampule of 1 mL |
| InChI key | ZELFLGGRLLOERW-YECZQDJWSA-N |
| InChI | 1S/C14H23NO.ClH/c1-5-14(11(2)10-15(3)4)12-7-6-8-13(16)9-12;/h6-9,11,14,16H,5,10H2,1-4H3;1H/t11-,14+;/m0./s1 |
| application(s) | forensics and toxicology |
| technique(s) | liquid chromatography (LC): suitable |
| format | single component solution |
| manufacturer/tradename | Cerilliant® |
| CAS_NO | 175591-09-0 |
| SMILES string | Cl.CC[C@H]([C@@H](C)CN(C)C)c1cccc(O)c1 |
| concentration | 1.0 mg/mL in methanol (as free base) |
| Quality Level | 300 |