Bulk Discount Available!
Theobromine, 100 mg (PHR1837-100MG)
MilliporeSigma® (Sigma-Aldrich)
$198.94
Earn points on this purchase
| mp | 345-350 °C |
| CofA | current certificate can be downloaded |
| storage temp. | 2-8°C |
| Quality Level | 300 |
| application(s) | pharmaceutical (small molecule) |
| InChI key | YAPQBXQYLJRXSA-UHFFFAOYSA-N |
| packaging | pkg of 100 mg |
| SMILES string | [H]N1C(N(C)C2=C(N(C)C=N2)C1=O)=O |
| CAS_NO | 83-67-0 |
| grade | certified reference material |
| agency | traceable to Ph. Eur. T0700000 |
| grade | pharmaceutical secondary standard |
| API family | theobromine |
| InChI | 1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2/h3H,1-2H3,(H,9,12,13) |
| form | powder |