Bulk Discount Available!
Thioflavine S, 1 X 25 g (T1892-25G)
MilliporeSigma® (Sigma-Aldrich)
$58.70
Earn points on this purchase
| application(s) | diagnostic assay manufacturinghematologyhistology |
| storage temp. | room temp |
| technique(s) | microbe id | staining: suitable |
| CAS_NO | 1326-12-1 |
| λmax | 360-380 |
| Quality Level | 200 |
| solubility | ethanol: water (1:1): 1 mg/mL |
| color | light beige to dark beige, to Dark Brown |
| SMILES string | S1c2c(ccc(c2)C)N(C1=C3C=CC(=[N+](C)C)C=C3)C.[Cl-] |
| form | powder |
| InChI | 1S/C17H19N2S.ClH/c1-12-5-10-15-16(11-12)20-17(19(15)4)13-6-8-14(9-7-13)18(2)3;/h5-11H,1-4H3;1H/q+1;/p-1 |
| grade | practical grade |
| InChI key | JADVWWSKYZXRGX-UHFFFAOYSA-M |