Bulk Discount Available!
(+)-α-Tocopherol acetate, 1 X 1 g (T1157-1G)
MilliporeSigma® (Sigma-Aldrich)
$25.31
Earn points on this purchase
| color | white to yellow |
| InChI | 1S/C31H52O3/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-19-31(9)20-18-28-26(7)29(33-27(8)32)24(5)25(6)30(28)34-31/h21-23H,10-20H2,1-9H3/t22-,23-,31-/m1/s1 |
| SMILES string | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(OC(C)=O)c(C)c(C)c2O1 |
| form | liquid (or semi-solid) |
| technique(s) | cell culture | insect: suitable |
| product line | BioReagent |
| purified by | crystallization |
| InChI key | ZAKOWWREFLAJOT-CEFNRUSXSA-N |
| CAS_NO | 58-95-7 |
| Quality Level | 200 |
| mol wt | Mw 472.74 g/mol |
| solubility | chloroform: soluble 50 mg/mL, clear, colorless to yellow |
| storage temp. | room temp |
| description | Synthesized from natural α-tocopherol |
| specific activity | ~1360 IU/g |
| biological source | plant |