Bulk Discount Available!
Tocopheryl Acetate, a, 1 X 500 mg (PHR1030-500MG)
MilliporeSigma® (Sigma-Aldrich)
$95.67
Earn points on this purchase
| density | 0.96 g/mL at 20 °C (lit.) |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| grade | pharmaceutical secondary standard |
| CAS_NO | 7695-91-2 |
| Quality Level | 300 |
| technique(s) | HPLC: suitable |
| grade | certified reference material |
| CofA | current certificate can be downloaded |
| application(s) | pharmaceutical (small molecule) |
| SMILES string | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(OC(C)=O)c(C)c(C)c2O1 |
| agency | traceable to USP 1667701 |
| format | neat |
| agency | traceable to Ph. Eur. T1600000 |
| InChI | 1S/C31H52O3/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-19-31(9)20-18-28-26(7)29(33-27(8)32)24(5)25(6)30(28)34-31/h21-23H,10-20H2,1-9H3/t22-,23-,31-/m1/s1 |
| API family | tocopherol |
| InChI key | ZAKOWWREFLAJOT-CEFNRUSXSA-N |