Bulk Discount Available!
Tolnaftate, 1 g (PHR1778-1G)
MilliporeSigma® (Sigma-Aldrich)
$279.41
Earn points on this purchase
| InChI | 1S/C19H17NOS/c1-14-6-5-9-17(12-14)20(2)19(22)21-18-11-10-15-7-3-4-8-16(15)13-18/h3-13H,1-2H3 |
| agency | traceable to USP 1671006 |
| technique(s) | gas chromatography (GC): suitable |
| InChI key | FUSNMLFNXJSCDI-UHFFFAOYSA-N |
| packaging | pkg of 1 g |
| technique(s) | HPLC: suitable |
| SMILES string | CN(C(=S)Oc1ccc2ccccc2c1)c3cccc(C)c3 |
| grade | pharmaceutical secondary standard |
| format | neat |
| storage temp. | 2-8°C |
| API family | tolnaftate |
| application(s) | pharmaceutical (small molecule) |
| agency | traceable to Ph. Eur. T1707000 |
| CofA | current certificate can be downloaded |
| CAS_NO | 2398-96-1 |
| grade | certified reference material |
| Quality Level | 300 |