Bulk Discount Available!
Triamterene, 400 mg (PHR1722-400MG)
MilliporeSigma® (Sigma-Aldrich)
$205.65
Earn points on this purchase
| CAS_NO | 396-01-0 |
| grade | pharmaceutical secondary standard |
| agency | traceable to USP 1680007 |
| InChI key | FNYLWPVRPXGIIP-UHFFFAOYSA-N |
| agency | traceable to Ph. Eur. Y0000837 |
| grade | certified reference material |
| Gene Information | human ... SCNN1A(6337), SCNN1B(6338), SCNN1G(6340) |
| storage temp. | 2-30°C |
| application(s) | pharmaceutical (small molecule) |
| packaging | pkg of 400 mg |
| technique(s) | HPLC: suitable |
| CofA | current certificate can be downloaded |
| SMILES string | Nc1nc(N)c2nc(-c3ccccc3)c(N)nc2n1 |
| technique(s) | gas chromatography (GC): suitable |
| API family | triamterene |
| format | neat |
| Quality Level | 300 |
| InChI | 1S/C12H11N7/c13-9-7(6-4-2-1-3-5-6)16-8-10(14)18-12(15)19-11(8)17-9/h1-5H,(H6,13,14,15,17,18,19) |