Bulk Discount Available!
XPhos, 1 X 5 g (638064-5G)
MilliporeSigma® (Sigma-Aldrich)
$196.71
Earn points on this purchase
| greener alternative category | , Re-engineered |
| reaction suitability | reagent type: ligandreaction type: Stille Coupling |
| SMILES string | CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C2=C(P(C3CCCCC3)C4CCCCC4)C=CC=C2 |
| reaction suitability | reagent type: ligandreaction type: Hiyama Coupling |
| CAS_NO | 564483-18-7 |
| reaction suitability | reagent type: ligandreaction type: Sonogashira Coupling |
| reaction suitability | reaction type: Cross Couplings |
| InChI key | UGOMMVLRQDMAQQ-UHFFFAOYSA-N |
| mp | 187-190 °C (lit.) |
| reaction suitability | reagent type: ligandreaction type: Suzuki-Miyaura Coupling |
| reaction suitability | reagent type: ligandreaction type: Heck Reaction |
| reaction suitability | reagent type: ligandreaction type: Negishi Coupling |
| functional group | phosphine |
| reaction suitability | reagent type: ligandreaction type: C-C Bond Formation |
| sustainability | Greener Alternative Product |
| greener alternative product characteristics | Waste PreventionAtom EconomyUse of Renewable FeedstocksCatalysisLearn more about the Principles of Green Chemistry. |
| greener alternative product score | old score: 2new score: 1Find out more about DOZNâ„¢ Scoring |
| assay | 98% |
| Quality Level | 300 |
| InChI | 1S/C33H49P/c1-23(2)26-21-30(24(3)4)33(31(22-26)25(5)6)29-19-13-14-20-32(29)34(27-15-9-7-10-16-27)28-17-11-8-12-18-28/h13-14,19-25,27-28H,7-12,15-18H2,1-6H3 |
| reaction suitability | reagent type: ligandreaction type: Buchwald-Hartwig Cross Coupling Reaction |